Skip to content

Algebra | GCSE - Wyatt's Notes

Intuition

Algebra is the language of generalisation — it lets you describe patterns and relationships without specifying exact numbers. The key insight is that a letter (like x) represents an unknown quantity, and equations describe constraints on that quantity. Solving an equation means finding the value that satisfies all constraints simultaneously.

Why variables matter: Without algebra, you’d need separate calculations for every specific case. With algebra, you can derive a general formula once (like the quadratic formula) and apply it to infinitely many cases. This is the power of abstraction — it’s what makes mathematics scalable.

Balancing equations intuition: An equation is like a balanced scale. Whatever you do to one side, you must do to the other to maintain equality. This is why you perform the same operation (add, subtract, multiply, divide) on both sides when solving equations. The goal is to isolate the variable on one side.

Algebra

Info: Board Coverage AQA Paper 1 & 2 | Edexcel Paper 1 & 2 | OCR Paper 1, 2, 3 | WJEC Unit 1 & 2

1. Algebraic Expressions

1.1 Simplifying Expressions

Like terms have the same variable part. They can be combined by addition and subtraction.

Worked Example. Simplify 4x23x+7x2+5x24x^2 - 3x + 7x^2 + 5x - 2.

(4+7)x2+(3+5)x2=11x2+2x2(4 + 7)x^2 + (-3 + 5)x - 2 = 11x^2 + 2x - 2

Worked Example. Expand and simplify 3(2x5)2(x+4)3(2x - 5) - 2(x + 4).

6x152x8=4x236x - 15 - 2x - 8 = 4x - 23

1.2 Expanding Brackets

Single bracket: a(b+c)=ab+aca(b + c) = ab + ac

Double brackets (FOIL): (a+b)(c+d)=ac+ad+bc+bd(a + b)(c + d) = ac + ad + bc + bd

Worked Example. Expand and simplify (2x+3)(x5)(2x + 3)(x - 5).

2x210x+3x15=2x27x152x^2 - 10x + 3x - 15 = 2x^2 - 7x - 15

Worked Example. Expand (x+4)2(x + 4)^2.

(x+4)(x+4)=x2+4x+4x+16=x2+8x+16(x + 4)(x + 4) = x^2 + 4x + 4x + 16 = x^2 + 8x + 16

Worked Example (Higher Tier). Expand and simplify (2x1)(3x+4)(x2)(2x - 1)(3x + 4)(x - 2).

First expand two brackets:

(2x1)(3x+4)=6x2+8x3x4=6x2+5x4(2x - 1)(3x + 4) = 6x^2 + 8x - 3x - 4 = 6x^2 + 5x - 4

Now multiply by the third:

(6x2+5x4)(x2)=6x312x2+5x210x4x+8=6x37x214x+8(6x^2 + 5x - 4)(x - 2) = 6x^3 - 12x^2 + 5x^2 - 10x - 4x + 8 = 6x^3 - 7x^2 - 14x + 8

Worked Example (Higher Tier). Expand and simplify (x+2)(x3)(2x1)(x + 2)(x - 3)(2x - 1).

First: (x+2)(x3)=x23x+2x6=x2x6(x + 2)(x - 3) = x^2 - 3x + 2x - 6 = x^2 - x - 6.

Then: (x2x6)(2x1)=2x3x22x2+x12x+6=2x33x211x+6(x^2 - x - 6)(2x - 1) = 2x^3 - x^2 - 2x^2 + x - 12x + 6 = 2x^3 - 3x^2 - 11x + 6.

1.3 Factorisation

Common factor: ab+ac=a(b+c)ab + ac = a(b + c)

Difference of two squares: a2b2=(ab)(a+b)a^2 - b^2 = (a - b)(a + b)

Quadratic trinomial: x2+bx+c=(x+p)(x+q)x^2 + bx + c = (x + p)(x + q) where p+q=bp + q = b and pq=cpq = c.

Worked Example. Factorise x29x^2 - 9.

x29=(x3)(x+3)x^2 - 9 = (x - 3)(x + 3)

Worked Example. Factorise x2+5x+6x^2 + 5x + 6.

We need p+q=5p + q = 5 and pq=6pq = 6Giving p=2p = 2 and q=3q = 3:

x2+5x+6=(x+2)(x+3)x^2 + 5x + 6 = (x + 2)(x + 3)

Worked Example. Factorise 6x2+17x+126x^2 + 17x + 12.

We need pq=6×12=72pq = 6 \times 12 = 72 and p+q=17p + q = 17. The values are p=8p = 8 and q=9q = 9.

6x2+8x+9x+12=2x(3x+4)+3(3x+4)=(2x+3)(3x+4)6x^2 + 8x + 9x + 12 = 2x(3x + 4) + 3(3x + 4) = (2x + 3)(3x + 4)

Worked Example (Higher Tier). Factorise x3xx^3 - x.

x3x=x(x21)=x(x1)(x+1)x^3 - x = x(x^2 - 1) = x(x - 1)(x + 1)

Worked Example (Higher Tier). Factorise 4x225y24x^2 - 25y^2.

4x225y2=(2x5y)(2x+5y)4x^2 - 25y^2 = (2x - 5y)(2x + 5y)

Worked Example (Higher Tier). Factorise x2+2x8x^2 + 2x - 8.

We need two numbers with product 8-8 and sum 22: these are 44 and 2-2.

x2+2x8=(x+4)(x2)x^2 + 2x - 8 = (x + 4)(x - 2)

Worked Example (Higher Tier). Factorise 12x22712x^2 - 27.

12x227=3(4x29)=3(2x3)(2x+3)12x^2 - 27 = 3(4x^2 - 9) = 3(2x - 3)(2x + 3)

Worked Example (Higher Tier). Factorise x416x^4 - 16.

This is a difference of two squares twice:

x416=(x24)(x2+4)=(x2)(x+2)(x2+4)x^4 - 16 = (x^2 - 4)(x^2 + 4) = (x - 2)(x + 2)(x^2 + 4)

Note that x2+4x^2 + 4 cannot be factorised further over the reals since x2+4=0x^2 + 4 = 0 has no real Solutions.

1.4 Algebraic Fractions (Higher Tier)

Worked Example. Simplify x29x2+5x+6\frac{x^2 - 9}{x^2 + 5x + 6}.

(x3)(x+3)(x+2)(x+3)=x3x+2\frac{(x - 3)(x + 3)}{(x + 2)(x + 3)} = \frac{x - 3}{x + 2}

Worked Example. Simplify x24x+4x24\frac{x^2 - 4x + 4}{x^2 - 4}.

(x2)2(x2)(x+2)=x2x+2\frac{(x - 2)^2}{(x - 2)(x + 2)} = \frac{x - 2}{x + 2}

Worked Example (Higher Tier). Simplify 2x28x2+4x+4\frac{2x^2 - 8}{x^2 + 4x + 4}.

2(x24)(x+2)2=2(x2)(x+2)(x+2)2=2(x2)x+2\frac{2(x^2 - 4)}{(x + 2)^2} = \frac{2(x - 2)(x + 2)}{(x + 2)^2} = \frac{2(x - 2)}{x + 2}

::warning When cancelling factors in algebraic fractions, always factorise first. Never cancel Individual terms across addition or subtraction.

2. Solving Equations

2.1 Linear Equations

A linear equation has the general form ax+b=cax + b = c where the highest power of xx is 1.

Worked Example. Solve 3(2x1)=4x+73(2x - 1) = 4x + 7.

6x3=4x+76x - 3 = 4x + 7 2x=102x = 10 x=5x = 5

Worked Example. Solve 2x+13=x24+1\frac{2x + 1}{3} = \frac{x - 2}{4} + 1.

Multiply through by 12:

4(2x+1)=3(x2)+124(2x + 1) = 3(x - 2) + 12 8x+4=3x6+128x + 4 = 3x - 6 + 12 8x+4=3x+68x + 4 = 3x + 6 5x=25x = 2 x=25x = \frac{2}{5}

Worked Example (Higher Tier). Solve 3x14x+23=x16\frac{3x - 1}{4} - \frac{x + 2}{3} = \frac{x - 1}{6}.

Multiply through by 12 (the LCM of 4, 3, and 6):

3(3x1)4(x+2)=2(x1)3(3x - 1) - 4(x + 2) = 2(x - 1) 9x34x8=2x29x - 3 - 4x - 8 = 2x - 2 5x11=2x25x - 11 = 2x - 2 3x=93x = 9 x=3x = 3

2.2 Quadratic Equations

A quadratic equation has the form ax2+bx+c=0ax^2 + bx + c = 0 with a0a \neq 0.

Method 1: Factorisation. If ax2+bx+cax^2 + bx + c factorises, set each factor equal to zero.

Worked Example. Solve x25x+6=0x^2 - 5x + 6 = 0.

(x2)(x3)=0(x - 2)(x - 3) = 0 x = 2 \mathrm{ or x = 3

Method 2: The quadratic formula. For ax2+bx+c=0ax^2 + bx + c = 0:

x=b±b24ac2ax = \frac{-b \pm \sqrt{b^2 - 4ac}}{2a}

Theorem. The discriminant Δ=b24ac\Delta = b^2 - 4ac determines the nature of the roots:

ConditionRoots
Δ>0\Delta \gt 0Two distinct real roots
Δ=0\Delta = 0One repeated real root
Δ<0\Delta \lt 0No real roots

Proof sketch. The formula gives x=b±Δ2ax = \frac{-b \pm \sqrt{\Delta}}{2a}. If Δ>0\Delta \gt 0The Square root is a positive real, giving two distinct values. If Δ=0\Delta = 0Both roots equal b2a\frac{-b}{2a}. If Δ<0\Delta \lt 0The square root is not real, so no real roots exist.

Worked Example. Solve 2x2+3x5=02x^2 + 3x - 5 = 0 using the formula.

x=3±9+404=3±494=3±74x = \frac{-3 \pm \sqrt{9 + 40}}{4} = \frac{-3 \pm \sqrt{49}}{4} = \frac{-3 \pm 7}{4}

x = 1 \mathrm{ or x = -\frac{5}{2}

Worked Example (Higher Tier). Find the values of kk for which x2+4x+k=0x^2 + 4x + k = 0 has equal Roots.

Equal roots means Δ=0\Delta = 0:

164k=0    k=416 - 4k = 0 \implies k = 4

Method 3: Completing the square.

ax2+bx+c=a(x+b2a)2b24ac4aax^2 + bx + c = a\left(x + \frac{b}{2a}\right)^2 - \frac{b^2 - 4ac}{4a}

Worked Example. Write x2+6x+2x^2 + 6x + 2 in completed square form and solve x2+6x+2=0x^2 + 6x + 2 = 0.

x2+6x+2=(x+3)29+2=(x+3)27x^2 + 6x + 2 = (x + 3)^2 - 9 + 2 = (x + 3)^2 - 7

(x+3)2=7    x+3=±7    x=3±7(x + 3)^2 = 7 \implies x + 3 = \pm\sqrt{7} \implies x = -3 \pm \sqrt{7}

Worked Example (Higher Tier). Find the minimum value of f(x)=2x212x+5f(x) = 2x^2 - 12x + 5 and the value of xx at which it occurs.

f(x)=2(x26x)+5=2((x3)29)+5=2(x3)218+5=2(x3)213f(x) = 2(x^2 - 6x) + 5 = 2\left((x - 3)^2 - 9\right) + 5 = 2(x - 3)^2 - 18 + 5 = 2(x - 3)^2 - 13

Since (x3)20(x - 3)^2 \geq 0The minimum value is 13-13 when x=3x = 3.

Worked Example (Higher Tier). Solve 3x25x2=03x^2 - 5x - 2 = 0.

Δ=25+24=49\Delta = 25 + 24 = 49.

x=5±76x = \frac{5 \pm 7}{6}

x = 2 \mathrm{ or x = -\frac{1}{3}

2.3 Simultaneous Equations

Linear-linear systems: Solve by elimination or substitution.

Worked Example. Solve the simultaneous equations:

{3x+2y=125xy=7\begin{cases} 3x + 2y = 12 \\ 5x - y = 7 \end{cases}

Multiply the second equation by 2: 10x2y=1410x - 2y = 14.

Add to the first: 13x=2613x = 26 So x=2x = 2.

Substitute back: 10y=710 - y = 7 So y=3y = 3.

Linear-quadratic systems: Substitute the linear equation into the quadratic.

Worked Example. Solve:

{y=x23x+2y=2x2\begin{cases} y = x^2 - 3x + 2 \\ y = 2x - 2 \end{cases}

Substituting: x23x+2=2x2x^2 - 3x + 2 = 2x - 2

x25x+4=0x^2 - 5x + 4 = 0 (x1)(x4)=0(x - 1)(x - 4) = 0 x = 1 \mathrm{ or x = 4

When x=1x = 1: y=0y = 0. When x=4x = 4: y=6y = 6.

Solutions: (1,0)(1, 0) and (4,6)(4, 6).

Worked Example (Higher Tier). Solve:

{x+2y=5x2+y2=10\begin{cases} x + 2y = 5 \\ x^2 + y^2 = 10 \end{cases}

From the first equation: x=52yx = 5 - 2y.

Substituting: (52y)2+y2=10(5 - 2y)^2 + y^2 = 10

2520y+4y2+y2=1025 - 20y + 4y^2 + y^2 = 10 5y220y+15=05y^2 - 20y + 15 = 0 y24y+3=0y^2 - 4y + 3 = 0 (y1)(y3)=0(y - 1)(y - 3) = 0

y=1y = 1: x=3x = 3. y=3y = 3: x=1x = -1.

Solutions: (3,1)(3, 1) and (1,3)(-1, 3).

Worked Example (Higher Tier). Solve:

{2x+y=8x2y2=12\begin{cases} 2x + y = 8 \\ x^2 - y^2 = 12 \end{cases}

From the first equation: y=82xy = 8 - 2x.

Substituting: x2(82x)2=12x^2 - (8 - 2x)^2 = 12

x2(6432x+4x2)=12x^2 - (64 - 32x + 4x^2) = 12

x264+32x4x2=12x^2 - 64 + 32x - 4x^2 = 12

3x2+32x76=0-3x^2 + 32x - 76 = 0

3x232x+76=03x^2 - 32x + 76 = 0

Δ=1024912=112=16×7\Delta = 1024 - 912 = 112 = 16 \times 7.

x=32±476=16±273x = \frac{32 \pm 4\sqrt{7}}{6} = \frac{16 \pm 2\sqrt{7}}{3}

3. Inequalities

3.1 Linear Inequalities

Solving linear inequalities follows the same rules as equations, with one critical difference.

:::caution When multiplying or dividing both sides of an inequality by a negative number, you must

Reverse the inequality sign. ::: Worked Example. Solve 32x>73 - 2x \gt 7.

2x>4-2x \gt 4 x<2x \lt -2

Worked Example. Solve 5x23\frac{5 - x}{2} \geq 3.

5x65 - x \geq 6 x1-x \geq 1 x1x \leq -1

3.2 Quadratic Inequalities

Worked Example. Solve x25x+60x^2 - 5x + 6 \leq 0.

Factorise: (x2)(x3)0(x - 2)(x - 3) \leq 0.

The expression changes sign at x=2x = 2 and x=3x = 3. We need the region where it is negative or zero:

2x32 \leq x \leq 3

Method for quadratic inequalities:

  1. Factorise the quadratic (or find roots).
  2. Sketch the sign of the expression in each region.
  3. Select the region(s) satisfying the inequality.

Worked Example (Higher Tier). Solve 2x2+3x5<02x^2 + 3x - 5 \lt 0.

Roots: x=1x = 1 and x=52x = -\frac{5}{2}.

Since the coefficient of x2x^2 is positive, the parabola opens upward. The expression is negative Between the roots:

52<x<1-\frac{5}{2} \lt x \lt 1

Worked Example (Higher Tier). Solve x2+4x+50-x^2 + 4x + 5 \geq 0.

Multiply by 1-1 (reversing the inequality): x24x50x^2 - 4x - 5 \leq 0.

Factorise: (x5)(x+1)0(x - 5)(x + 1) \leq 0.

1x5-1 \leq x \leq 5

3.3 Inequalities on a Number Line

  • Open circle at an endpoint: the value is not included (<\lt or >\gt).
  • Closed circle at an endpoint: the value is included (\leq or \geq).

3.4 Double Inequalities (Higher Tier)

Worked Example. Solve 3<2x+17-3 \lt 2x + 1 \leq 7.

Subtract 1 from all parts: 4<2x6-4 \lt 2x \leq 6.

Divide by 2: 2<x3-2 \lt x \leq 3.

3.5 Set Notation for Inequalities (Higher Tier)

The solution x>3x \gt 3 can be written as {xR:x>3}\{x \in \mathbb{R} : x \gt 3\} or using interval notation (3,)(3, \infty).

4. Sequences

4.1 Arithmetic Sequences

An arithmetic sequence has a constant common difference dd. The nn-th term is:

un=a+(n1)du_n = a + (n - 1)d

Where aa is the first term.

The sum of the first nn terms is:

Sn=n2(2a+(n1)d)=n2(a+l)S_n = \frac{n}{2}(2a + (n - 1)d) = \frac{n}{2}(a + l)

Where ll is the last term.

Proof of the sum formula. Write the sum forwards and backwards:

Sn=a+(a+d)+(a+2d)++(ld)+lS_n = a + (a + d) + (a + 2d) + \cdots + (l - d) + l Sn=l+(ld)+(l2d)++(a+d)+aS_n = l + (l - d) + (l - 2d) + \cdots + (a + d) + a

Adding: 2Sn=n(a+l)2S_n = n(a + l) So Sn=n(a+l)2S_n = \frac{n(a + l)}{2}. \blacksquare

Worked Example. Find the 20th term and the sum of the first 20 terms of 3,7,11,15,3, 7, 11, 15, \ldots.

Here a=3a = 3 and d=4d = 4.

u20=3+19×4=79u_{20} = 3 + 19 \times 4 = 79

S20=202(2×3+19×4)=10×82=820S_{20} = \frac{20}{2}(2 \times 3 + 19 \times 4) = 10 \times 82 = 820

Worked Example (Higher Tier). An arithmetic sequence has first term 5 and common difference 3. Find the value of nn for which un=137u_n = 137.

5+(n1)×3=1375 + (n - 1) \times 3 = 137 3(n1)=1323(n - 1) = 132 n1=44n - 1 = 44 n=45n = 45

Worked Example (Higher Tier). An arithmetic sequence has u3=14u_3 = 14 and u7=26u_7 = 26. Find aa and dd.

a + 2d = 14 \quad \mathrm{and \quad a + 6d = 26

Subtracting: 4d=124d = 12 So d=3d = 3. Then a=146=8a = 14 - 6 = 8.

The sequence is 8,11,14,17,8, 11, 14, 17, \ldots

4.2 Geometric Sequences

A geometric sequence has a constant common ratio rr. The nn-th term is:

un=arn1u_n = ar^{n-1}

Worked Example. Find the 8th term of 2,6,18,54,2, 6, 18, 54, \ldots.

Here a=2a = 2 and r=3r = 3.

u8=2×37=2×2187=4374u_8 = 2 \times 3^7 = 2 \times 2187 = 4374

Worked Example (Higher Tier). Find the sum of the first 10 terms of 1,2,4,8,1, -2, 4, -8, \ldots.

a = 1$$r = -2$$n = 10.

S10=1((2)101)21=102413=10233=341S_{10} = \frac{1((-2)^{10} - 1)}{-2 - 1} = \frac{1024 - 1}{-3} = \frac{1023}{-3} = -341

4.3 Quadratic and Other Sequences

A quadratic sequence has second differences that are constant.

Worked Example. Find the nn-th term of 2,6,12,20,30,2, 6, 12, 20, 30, \ldots.

First differences: 4,6,8,10,4, 6, 8, 10, \ldots

Second differences: 2,2,2,2, 2, 2, \ldots

Since the second difference is 2, the coefficient of n2n^2 is 2/2=12/2 = 1. So un=n2+bn+cu_n = n^2 + bn + c.

When n=1n = 1: 1+b+c=2    b+c=11 + b + c = 2 \implies b + c = 1

When n=2n = 2: 4+2b+c=6    2b+c=24 + 2b + c = 6 \implies 2b + c = 2

Subtracting: b=1b = 1 So c=0c = 0.

un=n2+nu_n = n^2 + n

Worked Example (Higher Tier). Find the nn-th term of 1,0,3,8,15,1, 0, -3, -8, -15, \ldots.

First differences: 1,3,5,7,-1, -3, -5, -7, \ldots

Second differences: 2,2,2,-2, -2, -2, \ldots

The coefficient of n2n^2 is 2/2=1-2/2 = -1. So un=n2+bn+cu_n = -n^2 + bn + c.

When n=1n = 1: 1+b+c=1    b+c=2-1 + b + c = 1 \implies b + c = 2

When n=2n = 2: 4+2b+c=0    2b+c=4-4 + 2b + c = 0 \implies 2b + c = 4

Subtracting: b=2b = 2 So c=0c = 0.

un=n2+2n=n(2n)u_n = -n^2 + 2n = n(2 - n)

4.4 Fibonacci-Type Sequences

Each term is the sum of the two preceding terms: un=un1+un2u_n = u_{n-1} + u_{n-2}.

Example: 1,1,2,3,5,8,13,21,1, 1, 2, 3, 5, 8, 13, 21, \ldots

Proposition. Every third Fibonacci number is even.

Proof. Consider the Fibonacci sequence modulo 2. The sequence of parities is: 1,1,0,1,1,0,1,1,0,1, 1, 0, 1, 1, 0, 1, 1, 0, \ldots (period 3). Therefore FnF_n is even if and only if 3n3 \mid n. \blacksquare

Proposition. gcd(Fm,Fn)=Fgcd(m,n)\gcd(F_m, F_n) = F_{\gcd(m, n)}.

This beautiful identity connects the Fibonacci sequence to the greatest common divisor. It explains Why consecutive Fibonacci numbers are coprime: gcd(Fn,Fn+1)=F1=1\gcd(F_n, F_{n+1}) = F_1 = 1.

5. Graphs of Functions

Adjust the parameters in the graph above to explore the relationships between variables.

5.1 Linear Graphs

The equation of a straight line is y=mx+cy = mx + c where mm is the gradient and cc is the yy-intercept.

Gradient formula: For two points (x1,y1)(x_1, y_1) and (x2,y2)(x_2, y_2):

m=y2y1x2x1m = \frac{y_2 - y_1}{x_2 - x_1}

Parallel lines have the same gradient. Perpendicular lines have gradients whose product is 1-1: m1m2=1m_1 m_2 = -1.

Proof of the perpendicular gradient property. If two lines with gradients m1m_1 and m2m_2 are Perpendicular, then the angle between them is 9090^{\circ}. The tangent of the angle between two Lines is m2m11+m1m2\frac{m_2 - m_1}{1 + m_1 m_2}. Setting this to be undefined (as tan90\tan 90^{\circ} is Undefined), the denominator 1+m1m2=01 + m_1 m_2 = 0Giving m1m2=1m_1 m_2 = -1. \blacksquare

Worked Example. Find the equation of the line through (2,5)(2, 5) perpendicular to y=3x1y = 3x - 1.

The gradient of the given line is 3. The perpendicular gradient is 13-\frac{1}{3}.

y5=13(x2)y - 5 = -\frac{1}{3}(x - 2) y=13x+23+5=13x+173y = -\frac{1}{3}x + \frac{2}{3} + 5 = -\frac{1}{3}x + \frac{17}{3}

Worked Example (Higher Tier). Find the equation of the perpendicular bisector of the line Segment joining A(1,3)A(1, 3) and B(7,1)B(7, -1).

Midpoint: M=(82,22)=(4,1)M = \left(\frac{8}{2}, \frac{2}{2}\right) = (4, 1).

Gradient of AB: m=1371=46=23m = \frac{-1 - 3}{7 - 1} = \frac{-4}{6} = -\frac{2}{3}.

Perpendicular gradient: 32\frac{3}{2}.

Equation: y1=32(x4)y - 1 = \frac{3}{2}(x - 4)I.e. 2y2=3x122y - 2 = 3x - 12Or 3x2y=103x - 2y = 10.

5.2 Quadratic Graphs

The graph of y=ax2+bx+cy = ax^2 + bx + c is a parabola. If a>0a \gt 0 it opens upward; if a<0a \lt 0 it Opens downward.

The turning point is at x=b2ax = -\frac{b}{2a}.

The line of symmetry is x=b2ax = -\frac{b}{2a}.

Worked Example. Sketch the graph of y=x24x+3y = x^2 - 4x + 3.

Factorise: y=(x1)(x3)y = (x - 1)(x - 3) So the roots are x=1x = 1 and x=3x = 3.

yy-intercept: (0,3)(0, 3).

Vertex: x=42=2x = -\frac{-4}{2} = 2, y=48+3=1y = 4 - 8 + 3 = -1. Vertex at (2,1)(2, -1).

The parabola opens upward with minimum at (2,1)(2, -1)Crossing the xx-axis at x=1x = 1 and x=3x = 3.

Worked Example (Higher Tier). Sketch the graph of y=2x2+8x6y = -2x^2 + 8x - 6.

Factorise: 2(x24x+3)=2(x1)(x3)-2(x^2 - 4x + 3) = -2(x - 1)(x - 3). Roots at x=1x = 1 and x=3x = 3.

yy-intercept: (0,6)(0, -6).

Vertex: x=84=2x = -\frac{8}{-4} = 2, y=8+166=2y = -8 + 16 - 6 = 2. Vertex at (2,2)(2, 2).

The parabola opens downward with maximum at (2,2)(2, 2).

5.3 Other Key Graphs

FunctionShapeKey features
y=x3y = x^3CubicPoint of inflection at origin
y=1xy = \frac{1}{x}ReciprocalAsymptotes at both axes
y=xy = \sqrt{x}Square rootStarts at origin, curves to the right
y=2xy = 2^xExponentialPasses through (0,1)(0, 1)Never negative
x2+y2=a2x^2 + y^2 = a^2Circle radius aaCentre at origin

5.4 Transformations of Graphs

TransformationEffect on graph
y=f(x)+cy = f(x) + cTranslate up by cc
y=f(xc)y = f(x - c)Translate right by cc
y=f(x)y = -f(x)Reflect in the xx-axis
y=f(x)y = f(-x)Reflect in the yy-axis
y=af(x)y = af(x)Vertical stretch, scale factor aa
y=f(ax)y = f(ax)Horizontal stretch, scale factor 1a\frac{1}{a}

Worked Example (Higher Tier). The graph of y=f(x)y = f(x) passes through (2,5)(2, 5). State the Coordinates of the corresponding point on the graph of y=f(x3)+1y = f(x - 3) + 1.

Translation right by 3, up by 1: (2+3,5+1)=(5,6)(2 + 3, 5 + 1) = (5, 6).

Worked Example (Higher Tier). Given f(x)=x2f(x) = x^2Sketch y=f(2x)+3y = -f(2x) + 3.

y=(2x)2+3=4x2+3y = -(2x)^2 + 3 = -4x^2 + 3. This is a parabola opening downward with vertex at (0,3)(0, 3)Narrower Than y=x2y = x^2 by a factor of 2 in the xx-direction.

6. Algebraic Fractions

6.1 Simplification

Worked Example. Simplify x29x2+5x+6\frac{x^2 - 9}{x^2 + 5x + 6}.

(x3)(x+3)(x+2)(x+3)=x3x+2\frac{(x - 3)(x + 3)}{(x + 2)(x + 3)} = \frac{x - 3}{x + 2}

6.2 Addition and Subtraction

Find a common denominator, then combine.

Worked Example. Simplify 3x+1+2x2\frac{3}{x + 1} + \frac{2}{x - 2}.

3(x2)+2(x+1)(x+1)(x2)=3x6+2x+2(x+1)(x2)=5x4(x+1)(x2)\frac{3(x - 2) + 2(x + 1)}{(x + 1)(x - 2)} = \frac{3x - 6 + 2x + 2}{(x + 1)(x - 2)} = \frac{5x - 4}{(x + 1)(x - 2)}

Worked Example (Higher Tier). Simplify 2xx211x+1\frac{2x}{x^2 - 1} - \frac{1}{x + 1}.

2x(x1)(x1)(x+1)=x+1(x1)(x+1)=1x1\frac{2x - (x - 1)}{(x - 1)(x + 1)} = \frac{x + 1}{(x - 1)(x + 1)} = \frac{1}{x - 1}

6.3 Solving Equations with Algebraic Fractions

Worked Example. Solve x+13+x24=5\frac{x + 1}{3} + \frac{x - 2}{4} = 5.

Multiply through by 12 (the LCM of 3 and 4):

4(x+1)+3(x2)=604(x + 1) + 3(x - 2) = 60 4x+4+3x6=604x + 4 + 3x - 6 = 60 7x2=607x - 2 = 60 7x=627x = 62 x=627x = \frac{62}{7}

Worked Example (Higher Tier). Solve 2x+1x3=x+4x+1\frac{2x + 1}{x - 3} = \frac{x + 4}{x + 1}.

Cross-multiply: (2x+1)(x+1)=(x+4)(x3)(2x + 1)(x + 1) = (x + 4)(x - 3).

2x2+3x+1=x2+x122x^2 + 3x + 1 = x^2 + x - 12 x2+2x+13=0x^2 + 2x + 13 = 0

Δ=452=48<0\Delta = 4 - 52 = -48 \lt 0. No real solutions.

7. Proof

7.1 Proof by Exhaustion

List all possible cases and verify each one.

Example. Prove that every integer squared leaves remainder 0, 1, or 4 when divided by 5.

Every integer is of the form 5k+r5k + r where r{0,1,2,3,4}r \in \{0, 1, 2, 3, 4\}.

(5k)2=25k2(5k)^2 = 25k^2: remainder 0. (5k+1)2=25k2+10k+1(5k + 1)^2 = 25k^2 + 10k + 1: remainder 1. (5k+2)2=25k2+20k+4(5k + 2)^2 = 25k^2 + 20k + 4: remainder 4. (5k+3)2=25k2+30k+9(5k + 3)^2 = 25k^2 + 30k + 9: remainder 4. (5k+4)2=25k2+40k+16(5k + 4)^2 = 25k^2 + 40k + 16: remainder 1.

All cases give remainder 0, 1, or 4. \blacksquare

7.2 Proof by Deduction

Start from known facts and use logical steps to reach a conclusion.

Example. Prove that the sum of two consecutive odd numbers is divisible by 4.

Let the consecutive odd numbers be 2n+12n + 1 and 2n+32n + 3 for integer n0n \geq 0.

Sum =(2n+1)+(2n+3)=4n+4=4(n+1)= (2n + 1) + (2n + 3) = 4n + 4 = 4(n + 1).

Since n+1n + 1 is an integer, the sum is a multiple of 4. \blacksquare

Example (Higher Tier). Prove that the product of any three consecutive integers is divisible By 6.

Let the three consecutive integers be nn, n+1n + 1 And n+2n + 2.

Among any three consecutive integers, one is divisible by 2 (even) and one is divisible by 3. Since 2 and 3 are coprime, their product 6 divides the product of the three integers. \blacksquare

Example (Higher Tier). Prove that the sum of the squares of any two consecutive integers, minus 1, is divisible by 8.

Let the consecutive integers be nn and n+1n + 1.

n2+(n+1)21=n2+n2+2n+11=2n2+2n=2n(n+1)n^2 + (n+1)^2 - 1 = n^2 + n^2 + 2n + 1 - 1 = 2n^2 + 2n = 2n(n + 1).

Since nn and n+1n + 1 are consecutive, one is even, so n(n+1)n(n+1) is even, meaning n(n+1)=2kn(n+1) = 2k for Some integer kk.

Therefore 2n(n+1)=4k2n(n+1) = 4kWhich is divisible by 4 but not necessarily by 8. The original claim that This is always divisible by 8 is false. For example, when n=1n = 1: 1+41=41 + 4 - 1 = 4Which is not Divisible by 8.

::warning Not every claim about numbers is true. When asked to prove something, first check whether The statement is actually correct with a small example.

7.3 Disproof by Counterexample

To disprove a statement, find a single example where it fails.

Example. “All prime numbers are odd.” Counterexample: 2 is prime and even.

Example. “If n2n^2 is divisible by 4, then nn is divisible by 4.” Counterexample: n=6n = 6: n2=36n^2 = 36 is divisible by 4, but 6 is not.

Example (Higher Tier). “The sum of two irrational numbers is irrational.” Counterexample: 2+(2)=0\sqrt{2} + (-\sqrt{2}) = 0Which is rational.

7.4 Proof with Functions (Higher Tier)

Example. Given f(x)=2x1f(x) = 2x - 1 and g(x)=x2+3g(x) = x^2 + 3Prove that fg(2)=gf(1)fg(-2) = gf(1).

f(2)=5f(-2) = -5, g(5)=25+3=28g(-5) = 25 + 3 = 28.

f(1)=1f(1) = 1, g(1)=1+3=4g(1) = 1 + 3 = 4.

fg(2)=g(f(2))=284=gf(1)fg(-2) = g(f(-2)) = 28 \neq 4 = gf(1).

So fg(2)gf(1)fg(-2) \neq gf(1) — the statement is false. This illustrates that fgGff \circ g \ne G \circ f.

Common Pitfalls

  • Forgetting to reverse the inequality sign when multiplying or dividing by a negative.
  • Incorrectly expanding (a+b)2(a + b)^2. It is a2+2ab+b2a^2 + 2ab + b^2Not a2+b2a^2 + b^2.
  • Squaring brackets incorrectly in completing the square. (x+3)2=x2+6x+9(x + 3)^2 = x^2 + 6x + 9Not x2+9x^2 + 9.
  • Confusing the turning point formula. The xx-coordinate is b2a-\frac{b}{2a}Not b2a\frac{b}{2a}.
  • Dropping solutions when solving quadratics. Always check both values from ±\pm in the formula.
  • Assuming all sequences are arithmetic. Always check the first differences.
  • Cancelling terms instead of factors in algebraic fractions. Factorise first.
  • Mistaking graph transformations. y=f(x+2)y = f(x + 2) shifts LEFT by 2, not right.
  • Forgetting domain restrictions when simplifying algebraic fractions (e.g., x1x \neq 1).
  • Losing a negative sign when expanding a bracket preceded by a minus sign. Expand (x3)-(x - 3) as x+3-x + 3Not x3-x - 3.
  • Incorrectly identifying the common difference of a geometric sequence as addition rather than multiplication. Arithmetic sequences add dd; geometric sequences multiply by rr.

Practice Questions

  1. Expand and simplify (3x2)(2x+5)(x+1)2(3x - 2)(2x + 5) - (x + 1)^2.

  2. Solve the simultaneous equations 2x+3y=132x + 3y = 13 and 4xy=54x - y = 5.

  3. Solve x27x+10=0x^2 - 7x + 10 = 0 by factorisation, and verify using the quadratic formula.

  4. Write 2x212x+52x^2 - 12x + 5 in completed square form. Hence state the minimum value and where it occurs.

  5. Solve the inequality x24x5>0x^2 - 4x - 5 \gt 0.

  6. The nn-th term of a sequence is n2+3nn^2 + 3n. Find the first 5 terms and the 50th term.

  7. Find the equation of the line through (1,4)(-1, 4) that is parallel to 2y=6x+52y = 6x + 5.

  8. Simplify x2+5x+6x24÷x+3x2\frac{x^2 + 5x + 6}{x^2 - 4} \div \frac{x + 3}{x - 2}.

  9. Prove that the product of three consecutive integers is always divisible by 6.

  10. Solve 2x+13x2=1\frac{2}{x + 1} - \frac{3}{x - 2} = 1.

  11. Find the equation of the line through (3,1)(3, -1) perpendicular to 2x+5y=102x + 5y = 10.

  12. Express x3xx21\frac{x^3 - x}{x^2 - 1} as a simplified algebraic fraction, stating any restriction on xx.

  13. Prove that the difference between the squares of any two consecutive integers is always odd.

  14. Solve x26x+20x^2 - 6x + 2 \leq 0Giving your answer in exact form.

  15. The first three terms of a geometric sequence are k,k+3,k+12k, k + 3, k + 12. Find the value of kk and the common ratio.

  16. Find the nn-th term of the sequence 5,10,17,26,37,5, 10, 17, 26, 37, \ldots.

  17. Disprove by counterexample: “The square root of any irrational number is irrational.”

  18. Find the values of kk for which kx26x+4=0kx^2 - 6x + 4 = 0 has two distinct real roots.

  19. Simplify x38x24\frac{x^3 - 8}{x^2 - 4}Stating any restriction on xx.

  20. Prove that for any positive integer nnThe number n3nn^3 - n is divisible by 6.

Worked Examples

Example 1:

A typical exam question on Algebra requires you to apply your knowledge to an unfamiliar context. Read the question carefully, identify the key concept being tested, and structure your answer using the appropriate terminology.

Example 2:

Multi-step problems in Algebra often combine two or more concepts. Break the problem down: identify what you need to find, recall the relevant formula or principle, substitute values, and state your answer with correct units or formatting.

flowchart TD
    A[2_Algebrax] --> B[Key Concepts]
    A --> C[Core Principles]
    A --> D[Practical Applications]
    B --> E[Fundamental definitions]
    C --> F[Design patterns]
    D --> G[Real-world usage]

Summary

This topic covers the mathematical techniques and concepts related to algebra, including key theorems, methods, and problem-solving approaches.

Key concepts include:

  • quadratic equations and the discriminant
  • simultaneous equations
  • polynomial division and the factor theorem
  • partial fractions
  • binomial expansion

Regular practice with a variety of question types is essential to build fluency and confidence in applying these mathematical techniques.

Cross-References

  • Ratio and Proportion — Proportional reasoning and direct proportion are special cases of linear equations.
  • Geometry and Measure — Coordinate geometry and equations of lines connect algebra to spatial reasoning.
  • Forces — Force calculations involve rearranging F = ma and solving linear equations.
  • Atomic Structure — Chemical equations and formulae require algebraic manipulation.